cas: 4049-39-2 — see every product listed under this CAS number, including other names
4–(Benzyloxy)–3–hydroxybenzaldehyde (CAS 4049-39-2) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 1g, 250mg, 5g. Offered by: GLPBio.
| brand | GLPBio |
|---|---|
| catalog number | GF28413-100mg |
| cas | 4049-39-2 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| GLPBio | 100mg | 522.15 Pln | |
| GLPBio | 1g | 891.91 Pln | |
| GLPBio | 250mg | 597.04 Pln | |
| GLPBio | 5g | 1832.69 Pln |
| purity | No data |
|---|---|
| delivery time | To be confirmed by Chemat |
3-hydroxy-4-phenylmethoxybenzaldehyde (CAS 4049-39-2) is a chemical compound with the molecular formula C14H12O3 and a molecular weight of 228.24 g/mol. IUPAC name: 3-hydroxy-4-phenylmethoxybenzaldehyde. InChIKey: HUNGEAFDVLSPAM-UHFFFAOYSA-N.
| Molecular formula | C14H12O3 |
|---|---|
| Molecular weight | 228.24 g/mol |
| IUPAC name | 3-hydroxy-4-phenylmethoxybenzaldehyde |
| InChIKey | HUNGEAFDVLSPAM-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)COC2=C(C=C(C=C2)C=O)O |
Computed by PubChem (NCBI)