cas: 4049-39-2 — see every product listed under this CAS number, including other names
4-(Benzyloxy)-3-Hydroxybenzaldehyde, 97%, 97% (CAS 4049-39-2) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g, 25g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11C1L1-100mg |
| cas | 4049-39-2 |
| size | 100mg |
| availability | 50g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 93.20 Pln | |
| Chemat | 250mg | 136.40 Pln | |
| Chemat | 1g | 256.40 Pln | |
| Chemat | 5g | 909.20 Pln | |
| Chemat | 10g | 1629.20 Pln | |
| Chemat | 25g | 3198.80 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
3-hydroxy-4-phenylmethoxybenzaldehyde (CAS 4049-39-2) is a chemical compound with the molecular formula C14H12O3 and a molecular weight of 228.24 g/mol. IUPAC name: 3-hydroxy-4-phenylmethoxybenzaldehyde. InChIKey: HUNGEAFDVLSPAM-UHFFFAOYSA-N.
| Molecular formula | C14H12O3 |
|---|---|
| Molecular weight | 228.24 g/mol |
| IUPAC name | 3-hydroxy-4-phenylmethoxybenzaldehyde |
| InChIKey | HUNGEAFDVLSPAM-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)COC2=C(C=C(C=C2)C=O)O |
Computed by PubChem (NCBI)