cas: 4049-39-2 — see every product listed under this CAS number, including other names
4-(Benzyloxy)-3-hydroxybenzaldehyde, 95% (CAS 4049-39-2) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F337086-100MG |
| cas | 4049-39-2 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100mg | 91.65 Pln | |
| Fluorochem | 250mg | 107.27 Pln | |
| Fluorochem | 1g | 190.58 Pln | |
| Fluorochem | 5g | 737.26 Pln | |
| Fluorochem | 10g | 1424.52 Pln |
| purity | 95% |
|---|---|
| delivery time | 3-4 weeks |
3-hydroxy-4-phenylmethoxybenzaldehyde (CAS 4049-39-2) is a chemical compound with the molecular formula C14H12O3 and a molecular weight of 228.24 g/mol. IUPAC name: 3-hydroxy-4-phenylmethoxybenzaldehyde. InChIKey: HUNGEAFDVLSPAM-UHFFFAOYSA-N.
| Molecular formula | C14H12O3 |
|---|---|
| Molecular weight | 228.24 g/mol |
| IUPAC name | 3-hydroxy-4-phenylmethoxybenzaldehyde |
| InChIKey | HUNGEAFDVLSPAM-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)COC2=C(C=C(C=C2)C=O)O |
Computed by PubChem (NCBI)