cas: 367-86-2 — see every product listed under this CAS number, including other names
4–Fluoro–3–nitrobenzotrifluoride (CAS 367-86-2) is a chemical reagent available from Chemat. Available pack sizes: 100g, 250g, 500g. Offered by: GLPBio.
| brand | GLPBio |
|---|---|
| catalog number | GD12785-100g |
| cas | 367-86-2 |
| size | 100g |
| brand | size | price | |
|---|---|---|---|
| GLPBio | 100g | 601.72 Pln | |
| GLPBio | 250g | 835.75 Pln | |
| GLPBio | 500g | 1037.01 Pln |
| purity | No data |
|---|---|
| delivery time | To be confirmed by Chemat |
1-fluoro-2-nitro-4-(trifluoromethyl)benzene (CAS 367-86-2) is a chemical compound with the molecular formula C7H3F4NO2 and a molecular weight of 209.10 g/mol. IUPAC name: 1-fluoro-2-nitro-4-(trifluoromethyl)benzene. InChIKey: HLDFCCHSOZWKAA-UHFFFAOYSA-N.
| Molecular formula | C7H3F4NO2 |
|---|---|
| Molecular weight | 209.10 g/mol |
| IUPAC name | 1-fluoro-2-nitro-4-(trifluoromethyl)benzene |
| InChIKey | HLDFCCHSOZWKAA-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1C(F)(F)F)[N+](=O)[O-])F |
Computed by PubChem (NCBI)