cas: 367-86-2 — see every product listed under this CAS number, including other names
4-Fluoro-3-nitrobenzotrifluoride, 96% (CAS 367-86-2) is a chemical reagent available from Chemat. Available pack sizes: 5g, 100g. Offered by: Thermo Scientific (Acros), Sigma-Aldrich.
| brand | Thermo Scientific (Acros) |
|---|---|
| catalog number | 200610050 |
| cas | 367-86-2 |
| size | 5g |
| availability | availability |
| brand | size | price | |
|---|---|---|---|
| Thermo Scientific (Acros) | 5g | 84.19 Pln | |
| Thermo Scientific (Acros) | 100g | 454.35 Pln | |
| Sigma-Aldrich | 100G | 274.00 Pln |
| delivery time | 2-3 weeks |
|---|---|
| category | Chemicals |
| purity | 96% |
1-fluoro-2-nitro-4-(trifluoromethyl)benzene (CAS 367-86-2) is a chemical compound with the molecular formula C7H3F4NO2 and a molecular weight of 209.10 g/mol. IUPAC name: 1-fluoro-2-nitro-4-(trifluoromethyl)benzene. InChIKey: HLDFCCHSOZWKAA-UHFFFAOYSA-N.
| Molecular formula | C7H3F4NO2 |
|---|---|
| Molecular weight | 209.10 g/mol |
| IUPAC name | 1-fluoro-2-nitro-4-(trifluoromethyl)benzene |
| InChIKey | HLDFCCHSOZWKAA-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1C(F)(F)F)[N+](=O)[O-])F |
Computed by PubChem (NCBI)