cas: 367-86-2 — see every product listed under this CAS number, including other names
4-Fluoro-3-nitrobenzotrifluoride (CAS 367-86-2) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 25g, 100g, 500g, 1kg. Offered by: Mikromol, Fluorochem.
| brand | Mikromol |
|---|---|
| catalog number | MM0182.09 |
| cas | 367-86-2 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Mikromol | 100mg | price on request | |
| Fluorochem | 25g | 138.51 Pln | |
| Fluorochem | 100g | 247.85 Pln | |
| Fluorochem | 500g | 1013.20 Pln | |
| Fluorochem | 1kg | 1924.34 Pln |
| purity | No data |
|---|---|
| delivery time | To be confirmed by Chemat |
1-fluoro-2-nitro-4-(trifluoromethyl)benzene (CAS 367-86-2) is a chemical compound with the molecular formula C7H3F4NO2 and a molecular weight of 209.10 g/mol. IUPAC name: 1-fluoro-2-nitro-4-(trifluoromethyl)benzene. InChIKey: HLDFCCHSOZWKAA-UHFFFAOYSA-N.
| Molecular formula | C7H3F4NO2 |
|---|---|
| Molecular weight | 209.10 g/mol |
| IUPAC name | 1-fluoro-2-nitro-4-(trifluoromethyl)benzene |
| InChIKey | HLDFCCHSOZWKAA-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1C(F)(F)F)[N+](=O)[O-])F |
Computed by PubChem (NCBI)