4-(2-Aminopyrimidin-5-yl)benzoic acid, 95%
cas: 222987-21-5 — see every product listed under this CAS number, including other names
4-(2-Aminopyrimidin-5-yl)benzoic acid, 95% (CAS 222987-21-5) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g, 25g. Offered by: Chemat, Fluorochem.
| brand | Chemat |
|---|---|
| catalog number | Ch11BD9G-100mg |
| cas | 222987-21-5 |
| size | 100mg |
| availability | 10g |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 141.20 Pln | |
| Chemat | 250mg | 179.60 Pln | |
| Chemat | 1g | 299.60 Pln | |
| Chemat | 5g | 1163.60 Pln | |
| Fluorochem | 100mg | 185.37 Pln | |
| Fluorochem | 250mg | 195.78 Pln | |
| Fluorochem | 1g | 325.94 Pln | |
| Fluorochem | 5g | 987.17 Pln | |
| Fluorochem | 10g | 1898.31 Pln | |
| Fluorochem | 25g | 4605.69 Pln |
properties
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
4-(2-aminopyrimidin-5-yl)benzoic acid (CAS 222987-21-5) is a chemical compound with the molecular formula C11H9N3O2 and a molecular weight of 215.21 g/mol. IUPAC name: 4-(2-aminopyrimidin-5-yl)benzoic acid. InChIKey: AHHQGKDKFINLBL-UHFFFAOYSA-N.
| Molecular formula | C11H9N3O2 |
|---|---|
| Molecular weight | 215.21 g/mol |
| IUPAC name | 4-(2-aminopyrimidin-5-yl)benzoic acid |
| InChIKey | AHHQGKDKFINLBL-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C2=CN=C(N=C2)N)C(=O)O |
Computed by PubChem (NCBI)