cas: 630125-69-8 — see every product listed under this CAS number, including other names
4-(4-Aminophenoxy)picolinonitrile 98% (CAS 630125-69-8) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A627955-100mg |
| cas | 630125-69-8 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 620.69 Pln | |
| Ambeed | 250mg | 993.38 Pln | |
| Ambeed | 1g | 2556.44 Pln |
| purity | 98% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A627955 |
4-(4-aminophenoxy)pyridine-2-carbonitrile (CAS 630125-69-8) is a chemical compound with the molecular formula C12H9N3O and a molecular weight of 211.22 g/mol. IUPAC name: 4-(4-aminophenoxy)pyridine-2-carbonitrile. InChIKey: GRAZISXKEOERSH-UHFFFAOYSA-N.
| Molecular formula | C12H9N3O |
|---|---|
| Molecular weight | 211.22 g/mol |
| IUPAC name | 4-(4-aminophenoxy)pyridine-2-carbonitrile |
| InChIKey | GRAZISXKEOERSH-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1N)OC2=CC(=NC=C2)C#N |
Computed by PubChem (NCBI)