cas: 95233-37-7 — see every product listed under this CAS number, including other names
4-(4-Chlorophenyl)cyclohexanecarboxylic acid 98% (trans) (CAS 95233-37-7) is a chemical reagent available from Chemat. Available pack sizes: 5g, 10g, 25g, 100g, 500g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A194353-5g |
| cas | 95233-37-7 |
| size | 5g |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 5g | 120.06 Pln | |
| Ambeed | 10g | 142.31 Pln | |
| Ambeed | 25g | 170.12 Pln | |
| Ambeed | 100g | 275.81 Pln | |
| Ambeed | 500g | 998.94 Pln |
| purity | 98% (trans) |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A194353 |
4-(4-chlorophenyl)cyclohexane-1-carboxylic acid (CAS 95233-37-7) is a chemical compound with the molecular formula C13H15ClO2 and a molecular weight of 238.71 g/mol. IUPAC name: 4-(4-chlorophenyl)cyclohexane-1-carboxylic acid. InChIKey: NXXDIEYTMQYWJU-UHFFFAOYSA-N.
| Molecular formula | C13H15ClO2 |
|---|---|
| Molecular weight | 238.71 g/mol |
| IUPAC name | 4-(4-chlorophenyl)cyclohexane-1-carboxylic acid |
| InChIKey | NXXDIEYTMQYWJU-UHFFFAOYSA-N |
| SMILES | C1CC(CCC1C2=CC=C(C=C2)Cl)C(=O)O |
Computed by PubChem (NCBI)