cas: 95233-37-7 — see every product listed under this CAS number, including other names
4-(4-Chlorophenyl)cyclohexanecarboxylic acid, 98% (trans), 98% (trans) (CAS 95233-37-7) is a chemical reagent available from Chemat. Available pack sizes: 5g, 10g, 25g, 100g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11IIVM-5g |
| cas | 95233-37-7 |
| size | 5g |
| availability | 300g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 5g | 74.00 Pln | |
| Chemat | 10g | 78.80 Pln | |
| Chemat | 25g | 83.60 Pln | |
| Chemat | 100g | 155.60 Pln |
| purity | 98% (trans) |
|---|---|
| delivery time | 3 weeks |
4-(4-chlorophenyl)cyclohexane-1-carboxylic acid (CAS 95233-37-7) is a chemical compound with the molecular formula C13H15ClO2 and a molecular weight of 238.71 g/mol. IUPAC name: 4-(4-chlorophenyl)cyclohexane-1-carboxylic acid. InChIKey: NXXDIEYTMQYWJU-UHFFFAOYSA-N.
| Molecular formula | C13H15ClO2 |
|---|---|
| Molecular weight | 238.71 g/mol |
| IUPAC name | 4-(4-chlorophenyl)cyclohexane-1-carboxylic acid |
| InChIKey | NXXDIEYTMQYWJU-UHFFFAOYSA-N |
| SMILES | C1CC(CCC1C2=CC=C(C=C2)Cl)C(=O)O |
Computed by PubChem (NCBI)