cas: 22479-78-3 — see every product listed under this CAS number, including other names
4-(4-Nitrophenoxy)phenol, 95% (CAS 22479-78-3) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F494044-250MG |
| cas | 22479-78-3 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 250mg | 1216.26 Pln | |
| Fluorochem | 1g | 2361.69 Pln |
| purity | 95% |
|---|---|
| delivery time | 3-4 weeks |
4-(4-nitrophenoxy)phenol (CAS 22479-78-3) is a chemical compound with the molecular formula C12H9NO4 and a molecular weight of 231.20 g/mol. IUPAC name: 4-(4-nitrophenoxy)phenol. InChIKey: DCCDSAOUQRQDEL-UHFFFAOYSA-N.
| Molecular formula | C12H9NO4 |
|---|---|
| Molecular weight | 231.20 g/mol |
| IUPAC name | 4-(4-nitrophenoxy)phenol |
| InChIKey | DCCDSAOUQRQDEL-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1[N+](=O)[O-])OC2=CC=C(C=C2)O |
Computed by PubChem (NCBI)