CAS 59866-98-7 appears in our catalog under these names: 5-Nitro-naphthalene-1-carboxylic acid methyl ester, 95%, Methyl 5-nitro-1-naphthoate, 97%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 250mg, 5g.
Methyl 5-nitronaphthalene-1-carboxylate (CAS 59866-98-7) is a chemical compound with the molecular formula C12H9NO4 and a molecular weight of 231.20 g/mol. IUPAC name: methyl 5-nitronaphthalene-1-carboxylate. InChIKey: VTWNAKCYACXMGI-UHFFFAOYSA-N.
| Molecular formula | C12H9NO4 |
|---|---|
| Molecular weight | 231.20 g/mol |
| IUPAC name | methyl 5-nitronaphthalene-1-carboxylate |
| InChIKey | VTWNAKCYACXMGI-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=CC=CC2=C1C=CC=C2[N+](=O)[O-] |
Computed by PubChem (NCBI)