cas: 1408143-67-8 — see every product listed under this CAS number, including other names
4-(Benzyloxy)-3,5-difluorobenzoic acid, ≥95%, ≥95% (CAS 1408143-67-8) is a chemical reagent available from Chemat. Available pack sizes: 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch12B7YE-1g |
| cas | 1408143-67-8 |
| size | 1g |
| availability | 5g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 1g | 1643.60 Pln |
| purity | ≥95% |
|---|---|
| delivery time | 3 weeks |
3,5-difluoro-4-phenylmethoxybenzoic acid (CAS 1408143-67-8) is a chemical compound with the molecular formula C14H10F2O3 and a molecular weight of 264.22 g/mol. IUPAC name: 3,5-difluoro-4-phenylmethoxybenzoic acid. InChIKey: CYRLDNFWXYDSQD-UHFFFAOYSA-N.
| Molecular formula | C14H10F2O3 |
|---|---|
| Molecular weight | 264.22 g/mol |
| IUPAC name | 3,5-difluoro-4-phenylmethoxybenzoic acid |
| InChIKey | CYRLDNFWXYDSQD-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)COC2=C(C=C(C=C2F)C(=O)O)F |
Computed by PubChem (NCBI)