cas: 886499-04-3 — see every product listed under this CAS number, including other names
4-(Bromomethyl)-2-fluoro-1-(trifluoromethoxy)benzene, 95+%, 95+% (CAS 886499-04-3) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch114JFI-250mg |
| cas | 886499-04-3 |
| size | 250mg |
| availability | 25g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 250mg | 266.00 Pln | |
| Chemat | 1g | 477.20 Pln | |
| Chemat | 5g | 1509.20 Pln |
| purity | 95+% |
|---|---|
| delivery time | 3 weeks |
4-(bromomethyl)-2-fluoro-1-(trifluoromethoxy)benzene (CAS 886499-04-3) is a chemical compound with the molecular formula C8H5BrF4O and a molecular weight of 273.02 g/mol. IUPAC name: 4-(bromomethyl)-2-fluoro-1-(trifluoromethoxy)benzene. InChIKey: MOWRYCSMYVKVNK-UHFFFAOYSA-N.
| Molecular formula | C8H5BrF4O |
|---|---|
| Molecular weight | 273.02 g/mol |
| IUPAC name | 4-(bromomethyl)-2-fluoro-1-(trifluoromethoxy)benzene |
| InChIKey | MOWRYCSMYVKVNK-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1CBr)F)OC(F)(F)F |
Computed by PubChem (NCBI)