CAS 1667-11-4 appears in our catalog under these names: 4–Phenylbenzyl chloride, 4-PHENYLBENZYL CHLORIDE, 98%, 4-Biphenylmethyl chloride, 96%, 4-(Chloromethyl)-1,1'-biphenyl, >98.0%(GC), 4-(Chloromethyl)-1,1'-biphenyl, 96%, 96%. Offered by: GLPBio, Sigma-Aldrich, Fluorochem, TCI, Chemat. Available pack sizes: 25g, 5g, 10G, 1g, 100g, 100mg, 250mg.
1-(chloromethyl)-4-phenylbenzene (CAS 1667-11-4) is a chemical compound with the molecular formula C13H11Cl and a molecular weight of 202.68 g/mol. IUPAC name: 1-(chloromethyl)-4-phenylbenzene. InChIKey: HLQZCRVEEQKNMS-UHFFFAOYSA-N.
| Molecular formula | C13H11Cl |
|---|---|
| Molecular weight | 202.68 g/mol |
| IUPAC name | 1-(chloromethyl)-4-phenylbenzene |
| InChIKey | HLQZCRVEEQKNMS-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=CC=C(C=C2)CCl |
Computed by PubChem (NCBI)