CAS 38580-82-4 is the registry number for 3-(Chloromethyl)-1,1'-biphenyl, 95+%. Offered by: AmBeed. Available pack sizes: 1g.
1-(chloromethyl)-3-phenylbenzene (CAS 38580-82-4) is a chemical compound with the molecular formula C13H11Cl and a molecular weight of 202.68 g/mol. IUPAC name: 1-(chloromethyl)-3-phenylbenzene. InChIKey: YKRYFMJQINAEOO-UHFFFAOYSA-N.
| Molecular formula | C13H11Cl |
|---|---|
| Molecular weight | 202.68 g/mol |
| IUPAC name | 1-(chloromethyl)-3-phenylbenzene |
| InChIKey | YKRYFMJQINAEOO-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=CC=CC(=C2)CCl |
Computed by PubChem (NCBI)