CAS 19482-17-8 appears in our catalog under these names: 4-Chloro-1-methyl-2-phenylbenzene, 95%, 5-Chloro-2-methyl-1,1'-biphenyl, 97%. Offered by: Combi-blocks, Ambeed. Available pack sizes: 5g, 10g, 1g, 250mg, 25g, 100g.
4-chloro-1-methyl-2-phenylbenzene (CAS 19482-17-8) is a chemical compound with the molecular formula C13H11Cl and a molecular weight of 202.68 g/mol. IUPAC name: 4-chloro-1-methyl-2-phenylbenzene. InChIKey: XQPZIHBHSJMJDO-UHFFFAOYSA-N.
| Molecular formula | C13H11Cl |
|---|---|
| Molecular weight | 202.68 g/mol |
| IUPAC name | 4-chloro-1-methyl-2-phenylbenzene |
| InChIKey | XQPZIHBHSJMJDO-UHFFFAOYSA-N |
| SMILES | CC1=C(C=C(C=C1)Cl)C2=CC=CC=C2 |
Computed by PubChem (NCBI)