Products 89346-57-6
CAS 89346-57-6 is the registry number for 4'-Chloro-2-methyl-1,1'-biphenyl, 95-<97%. Offered by: Hoffman Fine Chemicals. Available pack sizes: 1g, 2,5g, 5g, 10g, 25g.
1-chloro-4-(2-methylphenyl)benzene (CAS 89346-57-6) is a chemical compound with the molecular formula C13H11Cl and a molecular weight of 202.68 g/mol. IUPAC name: 1-chloro-4-(2-methylphenyl)benzene. InChIKey: RMESIKIOAHNIGO-UHFFFAOYSA-N.
| Molecular formula | C13H11Cl |
|---|---|
| Molecular weight | 202.68 g/mol |
| IUPAC name | 1-chloro-4-(2-methylphenyl)benzene |
| InChIKey | RMESIKIOAHNIGO-UHFFFAOYSA-N |
| SMILES | CC1=CC=CC=C1C2=CC=C(C=C2)Cl |
Computed by PubChem (NCBI)