Products 1330173-04-0
CAS 1330173-04-0 appears in our catalog under these names: 3-Chloro-2-methylbiphenyl-d5, 3-Chloro-2-methyl-1,1'-biphenyl-d5. Offered by: TRC, MedChemExpress. Available pack sizes: 100mg, 10mg, 100 mg, 10 mg.
1-(3-chloro-2-methylphenyl)-2,3,4,5,6-pentadeuteriobenzene (CAS 1330173-04-0) is a chemical compound with the molecular formula C13H11Cl and a molecular weight of 207.71 g/mol. IUPAC name: 1-(3-chloro-2-methylphenyl)-2,3,4,5,6-pentadeuteriobenzene. InChIKey: JNXJARJANRFDKX-QRKCWBMQSA-N.
| Molecular formula | C13H11Cl |
|---|---|
| Molecular weight | 207.71 g/mol |
| IUPAC name | 1-(3-chloro-2-methylphenyl)-2,3,4,5,6-pentadeuteriobenzene |
| InChIKey | JNXJARJANRFDKX-QRKCWBMQSA-N |
| SMILES | [2H]C1=C(C(=C(C(=C1[2H])[2H])C2=C(C(=CC=C2)Cl)C)[2H])[2H] |
Computed by PubChem (NCBI)