CAS 19482-09-8 is the registry number for 4-Chloro-3-methyl-1,1′-biphenyl, ≥95%, ≥95%. Offered by: Chemat. Available pack sizes: 1g.
1-chloro-2-methyl-4-phenylbenzene (CAS 19482-09-8) is a chemical compound with the molecular formula C13H11Cl and a molecular weight of 202.68 g/mol. IUPAC name: 1-chloro-2-methyl-4-phenylbenzene. InChIKey: RKCVWQISULVYFX-UHFFFAOYSA-N.
| Molecular formula | C13H11Cl |
|---|---|
| Molecular weight | 202.68 g/mol |
| IUPAC name | 1-chloro-2-methyl-4-phenylbenzene |
| InChIKey | RKCVWQISULVYFX-UHFFFAOYSA-N |
| SMILES | CC1=C(C=CC(=C1)C2=CC=CC=C2)Cl |
Computed by PubChem (NCBI)