CAS 29921-41-3 is the registry number for 2-Chlorodiphenylmethane. Offered by: Chemat Brand. Available pack sizes: on request.
1-benzyl-2-chlorobenzene (CAS 29921-41-3) is a chemical compound with the molecular formula C13H11Cl and a molecular weight of 202.68 g/mol. IUPAC name: 1-benzyl-2-chlorobenzene. InChIKey: IKKSPFNZXBWDQA-UHFFFAOYSA-N.
| Molecular formula | C13H11Cl |
|---|---|
| Molecular weight | 202.68 g/mol |
| IUPAC name | 1-benzyl-2-chlorobenzene |
| InChIKey | IKKSPFNZXBWDQA-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)CC2=CC=CC=C2Cl |
Computed by PubChem (NCBI)