CAS 831-81-2 appears in our catalog under these names: p-Chlorobenzylbenzene, 4–Chlorodiphenylmethane, 4-Chlorodiphenylmethane, >96.0%(GC), 4-Chlorodiphenylmethane 98%, 4-Chlorodiphenylmethane, 98%, 98%. Offered by: TRC, GLPBio, TCI, Ambeed, Chemat. Available pack sizes: 100g, 10g, 25g, 500g, 5g, 1g.
1-benzyl-4-chlorobenzene (CAS 831-81-2) is a chemical compound with the molecular formula C13H11Cl and a molecular weight of 202.68 g/mol. IUPAC name: 1-benzyl-4-chlorobenzene. InChIKey: NPOGRKGIBGKRNI-UHFFFAOYSA-N.
| Molecular formula | C13H11Cl |
|---|---|
| Molecular weight | 202.68 g/mol |
| IUPAC name | 1-benzyl-4-chlorobenzene |
| InChIKey | NPOGRKGIBGKRNI-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)CC2=CC=C(C=C2)Cl |
Computed by PubChem (NCBI)