CAS 19482-11-2 appears in our catalog under these names: 4–Chloro–4'–methyl–1,1'–biphenyl, 4-Chloro-4'-methyl-1,1'-biphenyl 95%, 4-Chloro-4'-methyl-1,1'-biphenyl, 95%, 95%, 4-Chloro-4'-methylbiphenyl, 95%. Offered by: GLPBio, Ambeed, Chemat, Fluorochem. Available pack sizes: 100mg, 250mg, 1g, 5g.
1-chloro-4-(4-methylphenyl)benzene (CAS 19482-11-2) is a chemical compound with the molecular formula C13H11Cl and a molecular weight of 202.68 g/mol. IUPAC name: 1-chloro-4-(4-methylphenyl)benzene. InChIKey: XYOKCUNCQZYSPK-UHFFFAOYSA-N.
| Molecular formula | C13H11Cl |
|---|---|
| Molecular weight | 202.68 g/mol |
| IUPAC name | 1-chloro-4-(4-methylphenyl)benzene |
| InChIKey | XYOKCUNCQZYSPK-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(C=C1)C2=CC=C(C=C2)Cl |
Computed by PubChem (NCBI)