4-(Dimethylcarbamoyl)benzene-1-sulfonyl chloride, 95%
cas: 190711-50-3 — see every product listed under this CAS number, including other names
4-(Dimethylcarbamoyl)benzene-1-sulfonyl chloride, 95% (CAS 190711-50-3) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 100mg. Offered by: Ambeed, BLDpharm, Chemat, Fluorochem.
| brand | Ambeed |
|---|---|
| catalog number | A1089050-250mg |
| cas | 190711-50-3 |
| size | 250mg |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 715.25 Pln | |
| Ambeed | 1g | 1382.75 Pln | |
| BLDpharm | 100mg | 558.72 Pln | |
| BLDpharm | 250mg | 764.20 Pln | |
| BLDpharm | 1g | 1486.17 Pln | |
| Chemat | 100mg | 606.80 Pln | |
| Chemat | 250mg | 986.00 Pln | |
| Chemat | 1g | 2560.40 Pln | |
| Fluorochem | 100mg | 1117.33 Pln | |
| Fluorochem | 250mg | 1825.42 Pln | |
| Fluorochem | 1g | 4741.06 Pln |
properties
| purity | 95% |
|---|---|
| delivery time | 1-2 weeks |
4-(dimethylcarbamoyl)benzenesulfonyl chloride (CAS 190711-50-3) is a chemical compound with the molecular formula C9H10ClNO3S and a molecular weight of 247.70 g/mol. IUPAC name: 4-(dimethylcarbamoyl)benzenesulfonyl chloride. InChIKey: APKXHLLIVVSYMP-UHFFFAOYSA-N.
| Molecular formula | C9H10ClNO3S |
|---|---|
| Molecular weight | 247.70 g/mol |
| IUPAC name | 4-(dimethylcarbamoyl)benzenesulfonyl chloride |
| InChIKey | APKXHLLIVVSYMP-UHFFFAOYSA-N |
| SMILES | CN(C)C(=O)C1=CC=C(C=C1)S(=O)(=O)Cl |
Computed by PubChem (NCBI)