Products 7139-88-0
CAS 7139-88-0 appears in our catalog under these names: 4-(Propionylamino)benzenesulfonyl chloride, 95%, 4-(Propionylamino)benzenesulfonyl chloride. Offered by: Combi-blocks, Biosynth. Available pack sizes: 5g, 1g, 2g, 10g.
4-(propanoylamino)benzenesulfonyl chloride (CAS 7139-88-0) is a chemical compound with the molecular formula C9H10ClNO3S and a molecular weight of 247.70 g/mol. IUPAC name: 4-(propanoylamino)benzenesulfonyl chloride. InChIKey: GLVXFKWVEJWTEB-UHFFFAOYSA-N.
| Molecular formula | C9H10ClNO3S |
|---|---|
| Molecular weight | 247.70 g/mol |
| IUPAC name | 4-(propanoylamino)benzenesulfonyl chloride |
| InChIKey | GLVXFKWVEJWTEB-UHFFFAOYSA-N |
| SMILES | CCC(=O)NC1=CC=C(C=C1)S(=O)(=O)Cl |
Computed by PubChem (NCBI)