Products 87223-30-1

CAS 87223-30-1 appears in our catalog under these names: 2-(Dimethylcarbamoyl)benzene-1-sulfonyl chloride, 95%, 2-(dimethylcarbamoyl)benzene-1-sulfonyl chloride, 98%, 98%. Offered by: Combi-blocks, Chemat. Available pack sizes: 250mg, 1g, 100mg.

Structural formula: {0} (CAS {1})

2-(dimethylcarbamoyl)benzenesulfonyl chloride (CAS 87223-30-1) is a chemical compound with the molecular formula C9H10ClNO3S and a molecular weight of 247.70 g/mol. IUPAC name: 2-(dimethylcarbamoyl)benzenesulfonyl chloride. InChIKey: WBDIEJDTFQYTIC-UHFFFAOYSA-N.

Identity
Molecular formulaC9H10ClNO3S
Molecular weight247.70 g/mol
IUPAC name2-(dimethylcarbamoyl)benzenesulfonyl chloride
InChIKeyWBDIEJDTFQYTIC-UHFFFAOYSA-N
SMILESCN(C)C(=O)C1=CC=CC=C1S(=O)(=O)Cl

Computed by PubChem (NCBI)