Products 1218096-17-3

CAS 1218096-17-3 is the registry number for 2-(5-Chlorothiophene-2-carboxamido)butanoic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.

2-[(5-chlorothiophene-2-carbonyl)amino]butanoic acid (CAS 1218096-17-3) is a chemical compound with the molecular formula C9H10ClNO3S and a molecular weight of 247.70 g/mol. IUPAC name: 2-[(5-chlorothiophene-2-carbonyl)amino]butanoic acid. InChIKey: IPHNAYJOSGDYMI-UHFFFAOYSA-N.

Identity
Molecular formulaC9H10ClNO3S
Molecular weight247.70 g/mol
IUPAC name2-[(5-chlorothiophene-2-carbonyl)amino]butanoic acid
InChIKeyIPHNAYJOSGDYMI-UHFFFAOYSA-N
SMILESCCC(C(=O)O)NC(=O)C1=CC=C(S1)Cl

Computed by PubChem (NCBI)