Products 28073-51-0

CAS 28073-51-0 appears in our catalog under these names: 4-(Acetylamino-methyl)-benzenesulfonyl chloride, 95%, 4-(Acetamidomethyl)benzene-1-sulfonyl chloride 97%, 4-(Acetamidomethyl)benzene-1-sulfonyl chloride, 97%, 97%. Offered by: Combi-blocks, Ambeed, Chemat. Available pack sizes: 5g, 10g, 250mg, 1g, 100mg.

Structural formula: {0} (CAS {1})

4-(acetamidomethyl)benzenesulfonyl chloride (CAS 28073-51-0) is a chemical compound with the molecular formula C9H10ClNO3S and a molecular weight of 247.70 g/mol. IUPAC name: 4-(acetamidomethyl)benzenesulfonyl chloride. InChIKey: WRGHKTBZVWARIA-UHFFFAOYSA-N.

Identity
Molecular formulaC9H10ClNO3S
Molecular weight247.70 g/mol
IUPAC name4-(acetamidomethyl)benzenesulfonyl chloride
InChIKeyWRGHKTBZVWARIA-UHFFFAOYSA-N
SMILESCC(=O)NCC1=CC=C(C=C1)S(=O)(=O)Cl

Computed by PubChem (NCBI)