CAS 116436-09-0 is the registry number for 2-(Acetylamino)-5-methylbenzenesulfonyl chloride, 96%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 10g, 5g, 1g.
2-acetamido-5-methylbenzenesulfonyl chloride (CAS 116436-09-0) is a chemical compound with the molecular formula C9H10ClNO3S and a molecular weight of 247.70 g/mol. IUPAC name: 2-acetamido-5-methylbenzenesulfonyl chloride. InChIKey: NGUFRGGRPQMFIX-UHFFFAOYSA-N.
| Molecular formula | C9H10ClNO3S |
|---|---|
| Molecular weight | 247.70 g/mol |
| IUPAC name | 2-acetamido-5-methylbenzenesulfonyl chloride |
| InChIKey | NGUFRGGRPQMFIX-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(C=C1)NC(=O)C)S(=O)(=O)Cl |
Computed by PubChem (NCBI)