Products 116436-09-0

CAS 116436-09-0 is the registry number for 2-(Acetylamino)-5-methylbenzenesulfonyl chloride, 96%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 10g, 5g, 1g.

Structural formula: {0} (CAS {1})

2-acetamido-5-methylbenzenesulfonyl chloride (CAS 116436-09-0) is a chemical compound with the molecular formula C9H10ClNO3S and a molecular weight of 247.70 g/mol. IUPAC name: 2-acetamido-5-methylbenzenesulfonyl chloride. InChIKey: NGUFRGGRPQMFIX-UHFFFAOYSA-N.

Identity
Molecular formulaC9H10ClNO3S
Molecular weight247.70 g/mol
IUPAC name2-acetamido-5-methylbenzenesulfonyl chloride
InChIKeyNGUFRGGRPQMFIX-UHFFFAOYSA-N
SMILESCC1=CC(=C(C=C1)NC(=O)C)S(=O)(=O)Cl

Computed by PubChem (NCBI)