CAS 62374-67-8 appears in our catalog under these names: 4-Acetylamino-2-methyl-benzenesulfonyl chloride, 95%, 4-Acetylamino-2-methylbenzenesulfonyl chloride, 95%, 4-Acetylamino-2-methyl-benzenesulfonyl chloride. Offered by: Combi-blocks, Chemat Brand, Biosynth. Available pack sizes: 10g, 5g, 1g, on request.
4-acetamido-2-methylbenzenesulfonyl chloride (CAS 62374-67-8) is a chemical compound with the molecular formula C9H10ClNO3S and a molecular weight of 247.70 g/mol. IUPAC name: 4-acetamido-2-methylbenzenesulfonyl chloride. InChIKey: CQMOYSYLLYARBD-UHFFFAOYSA-N.
| Molecular formula | C9H10ClNO3S |
|---|---|
| Molecular weight | 247.70 g/mol |
| IUPAC name | 4-acetamido-2-methylbenzenesulfonyl chloride |
| InChIKey | CQMOYSYLLYARBD-UHFFFAOYSA-N |
| SMILES | CC1=C(C=CC(=C1)NC(=O)C)S(=O)(=O)Cl |
Computed by PubChem (NCBI)