Products 869548-36-7

CAS 869548-36-7 is the registry number for 2-(5-Chlorothiophene-2-carboxamido)-2-methylpropanoic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.

Structural formula: {0} (CAS {1})

2-[(5-chlorothiophene-2-carbonyl)amino]-2-methylpropanoic acid (CAS 869548-36-7) is a chemical compound with the molecular formula C9H10ClNO3S and a molecular weight of 247.70 g/mol. IUPAC name: 2-[(5-chlorothiophene-2-carbonyl)amino]-2-methylpropanoic acid. InChIKey: IGAXWPNGVZMKQB-UHFFFAOYSA-N.

Identity
Molecular formulaC9H10ClNO3S
Molecular weight247.70 g/mol
IUPAC name2-[(5-chlorothiophene-2-carbonyl)amino]-2-methylpropanoic acid
InChIKeyIGAXWPNGVZMKQB-UHFFFAOYSA-N
SMILESCC(C)(C(=O)O)NC(=O)C1=CC=C(S1)Cl

Computed by PubChem (NCBI)