CAS 13632-07-0 appears in our catalog under these names: 5-Acetamido-2-methylbenzene-1-sulfonyl chloride, 95+%, 5-Acetylamino-2-methyl-benzenesulfonyl chloride. Offered by: AmBeed, Biosynth. Available pack sizes: 10g, 2,5g, 250mg.
5-acetamido-2-methylbenzenesulfonyl chloride (CAS 13632-07-0) is a chemical compound with the molecular formula C9H10ClNO3S and a molecular weight of 247.70 g/mol. IUPAC name: 5-acetamido-2-methylbenzenesulfonyl chloride. InChIKey: BCGUUSFEJVCVLK-UHFFFAOYSA-N.
| Molecular formula | C9H10ClNO3S |
|---|---|
| Molecular weight | 247.70 g/mol |
| IUPAC name | 5-acetamido-2-methylbenzenesulfonyl chloride |
| InChIKey | BCGUUSFEJVCVLK-UHFFFAOYSA-N |
| SMILES | CC1=C(C=C(C=C1)NC(=O)C)S(=O)(=O)Cl |
Computed by PubChem (NCBI)