Products 13632-07-0

CAS 13632-07-0 appears in our catalog under these names: 5-Acetamido-2-methylbenzene-1-sulfonyl chloride, 95+%, 5-Acetylamino-2-methyl-benzenesulfonyl chloride. Offered by: AmBeed, Biosynth. Available pack sizes: 10g, 2,5g, 250mg.

Structural formula: {0} (CAS {1})

5-acetamido-2-methylbenzenesulfonyl chloride (CAS 13632-07-0) is a chemical compound with the molecular formula C9H10ClNO3S and a molecular weight of 247.70 g/mol. IUPAC name: 5-acetamido-2-methylbenzenesulfonyl chloride. InChIKey: BCGUUSFEJVCVLK-UHFFFAOYSA-N.

Identity
Molecular formulaC9H10ClNO3S
Molecular weight247.70 g/mol
IUPAC name5-acetamido-2-methylbenzenesulfonyl chloride
InChIKeyBCGUUSFEJVCVLK-UHFFFAOYSA-N
SMILESCC1=C(C=C(C=C1)NC(=O)C)S(=O)(=O)Cl

Computed by PubChem (NCBI)