cas: 164220-57-9 — see every product listed under this CAS number, including other names
4-(trans-4-Ethylcyclohexyl)phenylboronic acid, 95%, 95% (CAS 164220-57-9) is a chemical reagent available from Chemat. Available pack sizes: 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch112UPB-1g |
| cas | 164220-57-9 |
| size | 1g |
| availability | 5g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 1g | 515.60 Pln |
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
[4-(4-ethylcyclohexyl)phenyl]boronic acid (CAS 164220-57-9) is a chemical compound with the molecular formula C14H21BO2 and a molecular weight of 232.13 g/mol. IUPAC name: [4-(4-ethylcyclohexyl)phenyl]boronic acid. InChIKey: QRCCELWUDZLZLP-UHFFFAOYSA-N.
| Molecular formula | C14H21BO2 |
|---|---|
| Molecular weight | 232.13 g/mol |
| IUPAC name | [4-(4-ethylcyclohexyl)phenyl]boronic acid |
| InChIKey | QRCCELWUDZLZLP-UHFFFAOYSA-N |
| SMILES | B(C1=CC=C(C=C1)C2CCC(CC2)CC)(O)O |
Computed by PubChem (NCBI)