cas: 162848-16-0 — see every product listed under this CAS number, including other names
4-[1,2,4]Triazol-1-yl-benzoic acid 95% (CAS 162848-16-0) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 25g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A174379-250mg |
| cas | 162848-16-0 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 175.69 Pln | |
| Ambeed | 1g | 275.81 Pln | |
| Ambeed | 5g | 804.25 Pln | |
| Ambeed | 25g | 2695.50 Pln |
| purity | 95% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A174379 |
4-(1,2,4-triazol-1-yl)benzoic acid (CAS 162848-16-0) is a chemical compound with the molecular formula C9H7N3O2 and a molecular weight of 189.17 g/mol. IUPAC name: 4-(1,2,4-triazol-1-yl)benzoic acid. InChIKey: FOMQQGKCPYKKHQ-UHFFFAOYSA-N.
| Molecular formula | C9H7N3O2 |
|---|---|
| Molecular weight | 189.17 g/mol |
| IUPAC name | 4-(1,2,4-triazol-1-yl)benzoic acid |
| InChIKey | FOMQQGKCPYKKHQ-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C(=O)O)N2C=NC=N2 |
Computed by PubChem (NCBI)