cas: 882847-29-2 — see every product listed under this CAS number, including other names
4-[2-({[(9h-fluoren-9-yl)methoxy]carbonyl}amino)ethoxy]benzoic acid, 98% (CAS 882847-29-2) is a chemical reagent available from Chemat. Available pack sizes: 50mg, 100mg, 250mg, 500mg, 1g, 2.5g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F669280-50MG |
| cas | 882847-29-2 |
| size | 50mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 50mg | 456.11 Pln | |
| Fluorochem | 100mg | 659.16 Pln | |
| Fluorochem | 250mg | 914.28 Pln | |
| Fluorochem | 500mg | 1408.90 Pln | |
| Fluorochem | 1g | 1794.18 Pln | |
| Fluorochem | 2.5g | 3080.18 Pln |
| purity | 98% |
|---|---|
| delivery time | 3-4 weeks |
4-[2-(9H-fluoren-9-ylmethoxycarbonylamino)ethoxy]benzoic acid (CAS 882847-29-2) is a chemical compound with the molecular formula C24H21NO5 and a molecular weight of 403.4 g/mol. IUPAC name: 4-[2-(9H-fluoren-9-ylmethoxycarbonylamino)ethoxy]benzoic acid. InChIKey: OHVLIOLJNXNLPK-UHFFFAOYSA-N.
| Molecular formula | C24H21NO5 |
|---|---|
| Molecular weight | 403.4 g/mol |
| IUPAC name | 4-[2-(9H-fluoren-9-ylmethoxycarbonylamino)ethoxy]benzoic acid |
| InChIKey | OHVLIOLJNXNLPK-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C(C3=CC=CC=C32)COC(=O)NCCOC4=CC=C(C=C4)C(=O)O |
Computed by PubChem (NCBI)