cas: 221124-57-8 — see every product listed under this CAS number, including other names
4-[Fmoc-(methyl)amino]butanoic acid, 98%, 98% (CAS 221124-57-8) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g, 25g, 50g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11BGJY-100mg |
| cas | 221124-57-8 |
| size | 100mg |
| availability | 100g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 98.00 Pln | |
| Chemat | 250mg | 107.60 Pln | |
| Chemat | 1g | 160.40 Pln | |
| Chemat | 5g | 544.40 Pln | |
| Chemat | 10g | 827.60 Pln | |
| Chemat | 25g | 1979.60 Pln | |
| Chemat | 50g | 3506.00 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
4-[9H-fluoren-9-ylmethoxycarbonyl(methyl)amino]butanoic acid (CAS 221124-57-8) is a chemical compound with the molecular formula C20H21NO4 and a molecular weight of 339.4 g/mol. IUPAC name: 4-[9H-fluoren-9-ylmethoxycarbonyl(methyl)amino]butanoic acid. InChIKey: FBMGMJCITYNTQX-UHFFFAOYSA-N.
| Molecular formula | C20H21NO4 |
|---|---|
| Molecular weight | 339.4 g/mol |
| IUPAC name | 4-[9H-fluoren-9-ylmethoxycarbonyl(methyl)amino]butanoic acid |
| InChIKey | FBMGMJCITYNTQX-UHFFFAOYSA-N |
| SMILES | CN(CCCC(=O)O)C(=O)OCC1C2=CC=CC=C2C3=CC=CC=C13 |
Computed by PubChem (NCBI)