cas: 5690-20-0 — see every product listed under this CAS number, including other names
4-Acetamidonaphthalene-1-sulfonyl chloride, 95% (CAS 5690-20-0) is a chemical reagent available from Chemat. Available pack sizes: 5g. Offered by: AmBeed.
| brand | AmBeed |
|---|---|
| catalog number | A719149-5g |
| cas | 5690-20-0 |
| size | 5g |
| availability | Synthetic Items: 0g |
| brand | size | price | |
|---|---|---|---|
| AmBeed | 5g | 10225.60 Pln |
| purity | 95% |
|---|---|
| delivery time | To be confirmed by Chemat |
4-acetamidonaphthalene-1-sulfonyl chloride (CAS 5690-20-0) is a chemical compound with the molecular formula C12H10ClNO3S and a molecular weight of 283.73 g/mol. IUPAC name: 4-acetamidonaphthalene-1-sulfonyl chloride. InChIKey: OMCFQVVRMGXXAF-UHFFFAOYSA-N.
| Molecular formula | C12H10ClNO3S |
|---|---|
| Molecular weight | 283.73 g/mol |
| IUPAC name | 4-acetamidonaphthalene-1-sulfonyl chloride |
| InChIKey | OMCFQVVRMGXXAF-UHFFFAOYSA-N |
| SMILES | CC(=O)NC1=CC=C(C2=CC=CC=C21)S(=O)(=O)Cl |
Computed by PubChem (NCBI)