CAS 187998-93-2 appears in our catalog under these names: 2-[(4-Chlorophenoxy)methyl]-4-methyl-1,3-thiazole-5-carboxylic acid, 95%, 2-(4-Chlorophenoxymethyl)-4-methyl-1,3-thiazole-5-carboxylic acid, 95%, 2-(4-Chlorophenoxymethyl)-4-methyl-1,3-thiazole-5-carboxylic acid. Offered by: Combi-blocks, AmBeed, Biosynth. Available pack sizes: 5g, 10g, 250mg, 1g, 100mg, 0,5g.
2-[(4-chlorophenoxy)methyl]-4-methyl-1,3-thiazole-5-carboxylic acid (CAS 187998-93-2) is a chemical compound with the molecular formula C12H10ClNO3S and a molecular weight of 283.73 g/mol. IUPAC name: 2-[(4-chlorophenoxy)methyl]-4-methyl-1,3-thiazole-5-carboxylic acid. InChIKey: WLJAYARWCGSCFD-UHFFFAOYSA-N.
| Molecular formula | C12H10ClNO3S |
|---|---|
| Molecular weight | 283.73 g/mol |
| IUPAC name | 2-[(4-chlorophenoxy)methyl]-4-methyl-1,3-thiazole-5-carboxylic acid |
| InChIKey | WLJAYARWCGSCFD-UHFFFAOYSA-N |
| SMILES | CC1=C(SC(=N1)COC2=CC=C(C=C2)Cl)C(=O)O |
Computed by PubChem (NCBI)