CAS 68227-70-3 is the registry number for o–chlorophenyl o–aminobenzenesulphonate. Offered by: GLPBio. Available pack sizes: 5g.
(2-chlorophenyl) 2-aminobenzenesulfonate (CAS 68227-70-3) is a chemical compound with the molecular formula C12H10ClNO3S and a molecular weight of 283.73 g/mol. IUPAC name: (2-chlorophenyl) 2-aminobenzenesulfonate. InChIKey: PYHMYLMGXGHSBK-UHFFFAOYSA-N.
| Molecular formula | C12H10ClNO3S |
|---|---|
| Molecular weight | 283.73 g/mol |
| IUPAC name | (2-chlorophenyl) 2-aminobenzenesulfonate |
| InChIKey | PYHMYLMGXGHSBK-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)N)S(=O)(=O)OC2=CC=CC=C2Cl |
Computed by PubChem (NCBI)