CAS 63301-13-3 is the registry number for 4-Chloro-N-(4-hydroxyphenyl)benzenesulfonamide, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
4-chloro-N-(4-hydroxyphenyl)benzenesulfonamide (CAS 63301-13-3) is a chemical compound with the molecular formula C12H10ClNO3S and a molecular weight of 283.73 g/mol. IUPAC name: 4-chloro-N-(4-hydroxyphenyl)benzenesulfonamide. InChIKey: MILGMZVNWOEDPJ-UHFFFAOYSA-N.
| Molecular formula | C12H10ClNO3S |
|---|---|
| Molecular weight | 283.73 g/mol |
| IUPAC name | 4-chloro-N-(4-hydroxyphenyl)benzenesulfonamide |
| InChIKey | MILGMZVNWOEDPJ-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1NS(=O)(=O)C2=CC=C(C=C2)Cl)O |
Computed by PubChem (NCBI)