CAS 144936-71-0 is the registry number for N-(3-Chlorobenzo[b]thiophene-2-carbonyl)-N-methylglycine, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
Methyl 2-[(3-chloro-1-benzothiophene-2-carbonyl)amino]acetate (CAS 144936-71-0) is a chemical compound with the molecular formula C12H10ClNO3S and a molecular weight of 283.73 g/mol. IUPAC name: methyl 2-[(3-chloro-1-benzothiophene-2-carbonyl)amino]acetate. InChIKey: LCNHTTSPODJGTO-UHFFFAOYSA-N.
| Molecular formula | C12H10ClNO3S |
|---|---|
| Molecular weight | 283.73 g/mol |
| IUPAC name | methyl 2-[(3-chloro-1-benzothiophene-2-carbonyl)amino]acetate |
| InChIKey | LCNHTTSPODJGTO-UHFFFAOYSA-N |
| SMILES | COC(=O)CNC(=O)C1=C(C2=CC=CC=C2S1)Cl |
Computed by PubChem (NCBI)