Products 5690-20-0
CAS 5690-20-0 appears in our catalog under these names: 4-(Acetylamino)naphthalene-1-sulfonyl chloride, 95%, 4-Acetamidonaphthalene-1-sulfonyl chloride, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 250mg, 1g, 5g.
4-acetamidonaphthalene-1-sulfonyl chloride (CAS 5690-20-0) is a chemical compound with the molecular formula C12H10ClNO3S and a molecular weight of 283.73 g/mol. IUPAC name: 4-acetamidonaphthalene-1-sulfonyl chloride. InChIKey: OMCFQVVRMGXXAF-UHFFFAOYSA-N.
| Molecular formula | C12H10ClNO3S |
|---|---|
| Molecular weight | 283.73 g/mol |
| IUPAC name | 4-acetamidonaphthalene-1-sulfonyl chloride |
| InChIKey | OMCFQVVRMGXXAF-UHFFFAOYSA-N |
| SMILES | CC(=O)NC1=CC=C(C2=CC=CC=C21)S(=O)(=O)Cl |
Computed by PubChem (NCBI)
Synonyms:
4-acetamidonaphthalene-1-sulfonyl Chloride, 4-(acetylamino)-1-naphthalenesulfonyl chloride, 1-Naphthalenesulfonyl chloride, 4-(acetylamino)-, OMCFQVVRMGXXAF-UHFFFAOYSA-N, 4-acetamidonaphthalene-1-sulfonylChloride, 4-acetamido-naphthalene-1-sulfonyl chloride, 4-(Acetylamino)-1-naphthalenesulfonyl chloride, AldrichCPR