CAS 885277-11-2 is the registry number for 3-(Benzyloxy)pyridine-2-sulfonyl chloride, 97%. Offered by: AmBeed. Available pack sizes: 1g.
3-phenylmethoxypyridine-2-sulfonyl chloride (CAS 885277-11-2) is a chemical compound with the molecular formula C12H10ClNO3S and a molecular weight of 283.73 g/mol. IUPAC name: 3-phenylmethoxypyridine-2-sulfonyl chloride. InChIKey: GQCGUZBQMGLOMP-UHFFFAOYSA-N.
| Molecular formula | C12H10ClNO3S |
|---|---|
| Molecular weight | 283.73 g/mol |
| IUPAC name | 3-phenylmethoxypyridine-2-sulfonyl chloride |
| InChIKey | GQCGUZBQMGLOMP-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)COC2=C(N=CC=C2)S(=O)(=O)Cl |
Computed by PubChem (NCBI)