CAS 52218-37-8 appears in our catalog under these names: 5-Acetamidonaphthalene-1-sulfonyl Chloride, 5-Acetamidonaphthalene-1-sulfonyl chloride, ≥95%, ≥95%. Offered by: TRC, Chemat. Available pack sizes: 10g, 1g, 5g, 50mg, 250mg.
5-acetamidonaphthalene-1-sulfonyl chloride (CAS 52218-37-8) is a chemical compound with the molecular formula C12H10ClNO3S and a molecular weight of 283.73 g/mol. IUPAC name: 5-acetamidonaphthalene-1-sulfonyl chloride. InChIKey: SCMTYCKLUSZRPQ-UHFFFAOYSA-N.
| Molecular formula | C12H10ClNO3S |
|---|---|
| Molecular weight | 283.73 g/mol |
| IUPAC name | 5-acetamidonaphthalene-1-sulfonyl chloride |
| InChIKey | SCMTYCKLUSZRPQ-UHFFFAOYSA-N |
| SMILES | CC(=O)NC1=CC=CC2=C1C=CC=C2S(=O)(=O)Cl |
Computed by PubChem (NCBI)