CAS 900814-15-5 appears in our catalog under these names: 4-(4-Chlorophenoxy)benzene-1-sulfonamide, 95%, 4-(4-Chlorophenoxy)benzene-1-sulfonamide. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 50mg, 0,5g.
4-(4-chlorophenoxy)benzenesulfonamide (CAS 900814-15-5) is a chemical compound with the molecular formula C12H10ClNO3S and a molecular weight of 283.73 g/mol. IUPAC name: 4-(4-chlorophenoxy)benzenesulfonamide. InChIKey: CXFMUGRTZZGJJL-UHFFFAOYSA-N.
| Molecular formula | C12H10ClNO3S |
|---|---|
| Molecular weight | 283.73 g/mol |
| IUPAC name | 4-(4-chlorophenoxy)benzenesulfonamide |
| InChIKey | CXFMUGRTZZGJJL-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1OC2=CC=C(C=C2)Cl)S(=O)(=O)N |
Computed by PubChem (NCBI)