cas: 1427082-83-4 — see every product listed under this CAS number, including other names
4-Acetyl-3-fluorobenzoic acid 95% (CAS 1427082-83-4) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A706340-100mg |
| cas | 1427082-83-4 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 270.25 Pln | |
| Ambeed | 250mg | 314.75 Pln | |
| Ambeed | 1g | 637.38 Pln |
| purity | 95% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A706340 |
4-acetyl-3-fluorobenzoic acid (CAS 1427082-83-4) is a chemical compound with the molecular formula C9H7FO3 and a molecular weight of 182.15 g/mol. IUPAC name: 4-acetyl-3-fluorobenzoic acid. InChIKey: BPEHVKSKTXMKNX-UHFFFAOYSA-N.
| Molecular formula | C9H7FO3 |
|---|---|
| Molecular weight | 182.15 g/mol |
| IUPAC name | 4-acetyl-3-fluorobenzoic acid |
| InChIKey | BPEHVKSKTXMKNX-UHFFFAOYSA-N |
| SMILES | CC(=O)C1=C(C=C(C=C1)C(=O)O)F |
Computed by PubChem (NCBI)