cas: 944-43-4 — see every product listed under this CAS number, including other names
4-Amino-2,3,5,6-tetrafluorobenzoic acid (CAS 944-43-4) is a chemical reagent available from Chemat. Available pack sizes: 200mg, 1g, 5g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F003133-200MG |
| cas | 944-43-4 |
| size | 200mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 200mg | 195.78 Pln | |
| Fluorochem | 1g | 560.24 Pln | |
| Fluorochem | 5g | 1757.73 Pln |
| delivery time | 3-4 weeks |
|---|
4-amino-2,3,5,6-tetrafluorobenzoic acid (CAS 944-43-4) is a chemical compound with the molecular formula C7H3F4NO2 and a molecular weight of 209.10 g/mol. IUPAC name: 4-amino-2,3,5,6-tetrafluorobenzoic acid. InChIKey: WTNSXWSOTDBWOR-UHFFFAOYSA-N.
| Molecular formula | C7H3F4NO2 |
|---|---|
| Molecular weight | 209.10 g/mol |
| IUPAC name | 4-amino-2,3,5,6-tetrafluorobenzoic acid |
| InChIKey | WTNSXWSOTDBWOR-UHFFFAOYSA-N |
| SMILES | C1(=C(C(=C(C(=C1F)F)N)F)F)C(=O)O |
Computed by PubChem (NCBI)