cas: 28311-31-1 — see every product listed under this CAS number, including other names
4-Amino-3-(4-chlorophenyl)butanoic acid hydrochloride (CAS 28311-31-1) is a chemical reagent available from Chemat. Available pack sizes: 2mg, 5mg, 10mg, 25mg, 50mg, 100mg, 200mg. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch12B39A-2mg |
| cas | 28311-31-1 |
| size | 2mg |
| availability | 0.2g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 2mg | 194.00 Pln | |
| Chemat | 5mg | 256.40 Pln | |
| Chemat | 10mg | 386.00 Pln | |
| Chemat | 25mg | 587.60 Pln | |
| Chemat | 50mg | 832.40 Pln | |
| Chemat | 100mg | 1192.40 Pln | |
| Chemat | 200mg | 1725.20 Pln |
| delivery time | 3 weeks |
|---|
4-amino-3-(4-chlorophenyl)butanoic acid;hydrochloride (CAS 28311-31-1) is a chemical compound with the molecular formula C10H13Cl2NO2 and a molecular weight of 250.12 g/mol. IUPAC name: 4-amino-3-(4-chlorophenyl)butanoic acid;hydrochloride. InChIKey: WMNUVYYLMCMHLU-UHFFFAOYSA-N.
| Molecular formula | C10H13Cl2NO2 |
|---|---|
| Molecular weight | 250.12 g/mol |
| IUPAC name | 4-amino-3-(4-chlorophenyl)butanoic acid;hydrochloride |
| InChIKey | WMNUVYYLMCMHLU-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C(CC(=O)O)CN)Cl.Cl |
Computed by PubChem (NCBI)