CAS 63701-56-4 appears in our catalog under these names: (S)-4-Amino-3-(4-chlorophenyl)butanoic acid hydrochloride, 98%, S()–Baclofen hydrochloride, (S)-Baclofen (hydrochloride). Offered by: AmBeed, GLPBio, MedChemExpress. Available pack sizes: 250mg, 50mg, 25mg, Get quote.
(3S)-4-amino-3-(4-chlorophenyl)butanoic acid;hydrochloride (CAS 63701-56-4) is a chemical compound with the molecular formula C10H13Cl2NO2 and a molecular weight of 250.12 g/mol. IUPAC name: (3S)-4-amino-3-(4-chlorophenyl)butanoic acid;hydrochloride. InChIKey: WMNUVYYLMCMHLU-DDWIOCJRSA-N.
| Molecular formula | C10H13Cl2NO2 |
|---|---|
| Molecular weight | 250.12 g/mol |
| IUPAC name | (3S)-4-amino-3-(4-chlorophenyl)butanoic acid;hydrochloride |
| InChIKey | WMNUVYYLMCMHLU-DDWIOCJRSA-N |
| SMILES | C1=CC(=CC=C1[C@H](CC(=O)O)CN)Cl.Cl |
Computed by PubChem (NCBI)