CAS 1261953-83-6 appears in our catalog under these names: 2-Amino-5-(4-formylphenyl)nicotinic acid, 95%, 2-Amino-5-(4-formylphenyl)nicotinic acid, 95+%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 100mg.
2-amino-5-(4-formylphenyl)pyridine-3-carboxylic acid (CAS 1261953-83-6) is a chemical compound with the molecular formula C13H10N2O3 and a molecular weight of 242.23 g/mol. IUPAC name: 2-amino-5-(4-formylphenyl)pyridine-3-carboxylic acid. InChIKey: SIKDKDMFLKXFLD-UHFFFAOYSA-N.
| Molecular formula | C13H10N2O3 |
|---|---|
| Molecular weight | 242.23 g/mol |
| IUPAC name | 2-amino-5-(4-formylphenyl)pyridine-3-carboxylic acid |
| InChIKey | SIKDKDMFLKXFLD-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C=O)C2=CC(=C(N=C2)N)C(=O)O |
Computed by PubChem (NCBI)